C11H15N7O3 — CID 80832674
4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione (PubChem CID 80832674) has the molecular formula C11H15N7O3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione.
| Compound Name | 4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80832674 |
| Molecular Formula | C11H15N7O3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione |
| SMILES | Nc1nc(N2CCOCC2)nc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C11H15N7O3/c12-9-14-10(17-1-3-21-4-2-17)16-11(15-9)18-5-7(19)13-8(20)6-18/h1-6H2,(H,13,19,20)(H2,12,14,15,16) |
| InChIKey | JXLLDFIOMUQKIW-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|