C7H7ClN6O2 — CID 80855882
4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazine-2,6-dione (PubChem CID 80855882) has the molecular formula C7H7ClN6O2 and a molecular weight of 242.63 g/mol. Its IUPAC name is 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazine-2,6-dione.
| Compound Name | 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80855882 |
| Molecular Formula | C7H7ClN6O2 |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)piperazine-2,6-dione |
| SMILES | Nc1nc(Cl)nc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C7H7ClN6O2/c8-5-11-6(9)13-7(12-5)14-1-3(15)10-4(16)2-14/h1-2H2,(H,10,15,16)(H2,9,11,12,13) |
| InChIKey | RLFIXXNZKUKSKB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|