C10H10N8O2 — CID 80855886
4-(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione (PubChem CID 80855886) has the molecular formula C10H10N8O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione.
| Compound Name | 4-(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80855886 |
| Molecular Formula | C10H10N8O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-(4-amino-6-imidazol-1-yl-1,3,5-triazin-2-yl)piperazine-2,6-dione |
| SMILES | Nc1nc(N2CC(=O)NC(=O)C2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H10N8O2/c11-8-14-9(17-2-1-12-5-17)16-10(15-8)18-3-6(19)13-7(20)4-18/h1-2,5H,3-4H2,(H,13,19,20)(H2,11,14,15,16) |
| InChIKey | YQTHEKQDJDCBOA-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|