C11H17N7O2 — CID 80855576
4-[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]piperazine-2,6-dione (PubChem CID 80855576) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]piperazine-2,6-dione.
| Compound Name | 4-[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80855576 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]piperazine-2,6-dione |
| SMILES | CCN(CC)c1nc(N)nc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C11H17N7O2/c1-3-17(4-2)10-14-9(12)15-11(16-10)18-5-7(19)13-8(20)6-18/h3-6H2,1-2H3,(H,13,19,20)(H2,12,14,15,16) |
| InChIKey | GTRZTIPWXDKEJW-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|