C13H20N8 — CID 80811437
6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80811437) has the molecular formula C13H20N8 and a molecular weight of 288.36 g/mol. Its IUPAC name is 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80811437 |
| Molecular Formula | C13H20N8 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(N2CCn3ccnc3C2)n1 |
| InChI | InChI=1S/C13H20N8/c1-3-19(4-2)12-16-11(14)17-13(18-12)21-8-7-20-6-5-15-10(20)9-21/h5-6H,3-4,7-9H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | SQGPMWUWIPEYDU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |