About 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine
5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine (PubChem CID 66013841) has the molecular formula C12H18N6
and a molecular weight of 246.32 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine |
| PubChem CID | 66013841 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine |
| SMILES | CCc1nn(C)c(N2CCn3ccnc3C2)c1N |
| InChI | InChI=1S/C12H18N6/c1-3-9-11(13)12(16(2)15-9)18-7-6-17-5-4-14-10(17)8-18/h4-5H,3,6-8,13H2,1-2H3 |
| InChIKey | RJEHIQFAXDCZNX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine?
The IUPAC name of 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine (CID 66013841) is 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine.
What is the SMILES notation for 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine?
The canonical SMILES for 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine is CCc1nn(C)c(N2CCn3ccnc3C2)c1N.
What is the InChIKey of 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine?
The InChIKey is RJEHIQFAXDCZNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6/c1-3-9-11(13)12(16(2)15-9)18-7-6-17-5-4-14-10(17)8-18/h4-5H,3,6-8,13H2,1-2H3.
What are the key properties of 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine?
5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine has a molecular weight of 246.32 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-ethyl-1-methylpyrazol-4-amine is sourced from PubChem (CID 66013841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).