C12H16N6S — CID 63757247
5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63757247) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63757247 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N2CCn3ccnc3C2)c1C(N)=S |
| InChI | InChI=1S/C12H16N6S/c1-8-10(11(13)19)12(16(2)15-8)18-6-5-17-4-3-14-9(17)7-18/h3-4H,5-7H2,1-2H3,(H2,13,19) |
| InChIKey | YGQOVAPZTRGMKV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|