C11H16N8 — CID 64576688
5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 64576688) has the molecular formula C11H16N8 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 64576688 |
| Molecular Formula | C11H16N8 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H16N8/c1-7-9(10(12)13)11(17(2)16-7)18-3-4-19-6-14-15-8(19)5-18/h6H,3-5H2,1-2H3,(H3,12,13) |
| InChIKey | IJLJMJDCFXJRCD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|