C10H16N4S — CID 63757362
1,3-dimethyl-5-pyrrolidin-1-ylpyrazole-4-carbothioamide (PubChem CID 63757362) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-pyrrolidin-1-ylpyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-pyrrolidin-1-ylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63757362 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1,3-dimethyl-5-pyrrolidin-1-ylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N2CCCC2)c1C(N)=S |
| InChI | InChI=1S/C10H16N4S/c1-7-8(9(11)15)10(13(2)12-7)14-5-3-4-6-14/h3-6H2,1-2H3,(H2,11,15) |
| InChIKey | JDZNVVUIESPFNU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|