C13H21N5OS — CID 103195947
1-(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)-N-methylpiperidine-3-carboxamide (PubChem CID 103195947) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103195947 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(4-carbamothioyl-1,3-dimethylpyrazol-5-yl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(c2c(C(N)=S)c(C)nn2C)C1 |
| InChI | InChI=1S/C13H21N5OS/c1-8-10(11(14)20)13(17(3)16-8)18-6-4-5-9(7-18)12(19)15-2/h9H,4-7H2,1-3H3,(H2,14,20)(H,15,19) |
| InChIKey | ZVFMPXFTNUKMLH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|