C11H18N4OS — CID 63756175
5-(3-hydroxypiperidin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63756175) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 5-(3-hydroxypiperidin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(3-hydroxypiperidin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756175 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-(3-hydroxypiperidin-1-yl)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N2CCCC(O)C2)c1C(N)=S |
| InChI | InChI=1S/C11H18N4OS/c1-7-9(10(12)17)11(14(2)13-7)15-5-3-4-8(16)6-15/h8,16H,3-6H2,1-2H3,(H2,12,17) |
| InChIKey | ZBRMXEGQWJKRPD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|