C13H23N5O — CID 55242512
5-(3-ethylpiperidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 55242512) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-(3-ethylpiperidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(3-ethylpiperidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 55242512 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 5-(3-ethylpiperidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | CCC1CCCN(c2c(/C(N)=N/O)c(C)nn2C)C1 |
| InChI | InChI=1S/C13H23N5O/c1-4-10-6-5-7-18(8-10)13-11(12(14)16-19)9(2)15-17(13)3/h10,19H,4-8H2,1-3H3,(H2,14,16) |
| InChIKey | VMOZKZIMJNWLMT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|