C12H22N6O — CID 76952238
5-(4-ethylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 76952238) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 5-(4-ethylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(4-ethylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952238 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 5-(4-ethylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | CCN1CCN(c2c(C(N)=NO)c(C)nn2C)CC1 |
| InChI | InChI=1S/C12H22N6O/c1-4-17-5-7-18(8-6-17)12-10(11(13)15-19)9(2)14-16(12)3/h19H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | ULNRUIQTRXMGHK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|