C12H21N5O3 — CID 103534006
5-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 103534006) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 103534006 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | COC1CN(c2c(C(N)=NO)c(C)nn2C)CC1OC |
| InChI | InChI=1S/C12H21N5O3/c1-7-10(11(13)15-18)12(16(2)14-7)17-5-8(19-3)9(6-17)20-4/h8-9,18H,5-6H2,1-4H3,(H2,13,15) |
| InChIKey | KTPKRYJFDNEGIJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|