C13H24N6O — CID 76952372
5-(3-ethyl-4-methylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 76952372) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is 5-(3-ethyl-4-methylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(3-ethyl-4-methylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952372 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 5-(3-ethyl-4-methylpiperazin-1-yl)-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | CCC1CN(c2c(C(N)=NO)c(C)nn2C)CCN1C |
| InChI | InChI=1S/C13H24N6O/c1-5-10-8-19(7-6-17(10)3)13-11(12(14)16-20)9(2)15-18(13)4/h10,20H,5-8H2,1-4H3,(H2,14,16) |
| InChIKey | JCWWWDGKGASHRE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|