C14H16N4S — CID 55149598
4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-methylbenzenecarbothioamide (PubChem CID 55149598) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-methylbenzenecarbothioamide.
| Compound Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 55149598 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-methylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C14H16N4S/c1-10-8-11(14(15)19)2-3-12(10)18-7-6-17-5-4-16-13(17)9-18/h2-5,8H,6-7,9H2,1H3,(H2,15,19) |
| InChIKey | SEXQHMVEYTZBIE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|