About 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline
5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline (PubChem CID 63014980) has the molecular formula C12H13ClN4
and a molecular weight of 248.72 g/mol. Its IUPAC name is 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline |
| PubChem CID | 63014980 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline |
| SMILES | Nc1cc(Cl)ccc1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H13ClN4/c13-9-1-2-11(10(14)7-9)17-6-5-16-4-3-15-12(16)8-17/h1-4,7H,5-6,8,14H2 |
| InChIKey | IGYSCRLMPBVDAL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline?
The IUPAC name of 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline (CID 63014980) is 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline.
What is the SMILES notation for 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline?
The canonical SMILES for 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline is Nc1cc(Cl)ccc1N1CCn2ccnc2C1.
What is the InChIKey of 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline?
The InChIKey is IGYSCRLMPBVDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4/c13-9-1-2-11(10(14)7-9)17-6-5-16-4-3-15-12(16)8-17/h1-4,7H,5-6,8,14H2.
What are the key properties of 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline?
5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline has a molecular weight of 248.72 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)aniline is sourced from PubChem (CID 63014980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).