C14H16ClN3O — CID 55149781
1-[3-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol (PubChem CID 55149781) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-[3-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol.
| Compound Name | 1-[3-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 55149781 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[3-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCn3ccnc3C2)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O/c1-10(19)11-2-3-13(12(15)8-11)18-7-6-17-5-4-16-14(17)9-18/h2-5,8,10,19H,6-7,9H2,1H3 |
| InChIKey | VNPKIDBANPSYDW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|