C14H16BrN3O — CID 63371929
(1R)-1-[3-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol (PubChem CID 63371929) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 63371929 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (1R)-1-[3-bromo-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCn3ccnc3C2)c(Br)c1 |
| InChI | InChI=1S/C14H16BrN3O/c1-10(19)11-2-3-13(12(15)8-11)18-7-6-17-5-4-16-14(17)9-18/h2-5,8,10,19H,6-7,9H2,1H3/t10-/m1/s1 |
| InChIKey | PXWBJXBXPMDOPF-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|