C13H16BrNO — CID 104921365
(1R)-1-[3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanol (PubChem CID 104921365) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 104921365 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (1R)-1-[3-bromo-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CC=CCC2)c(Br)c1 |
| InChI | InChI=1S/C13H16BrNO/c1-10(16)11-5-6-13(12(14)9-11)15-7-3-2-4-8-15/h2-3,5-6,9-10,16H,4,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | ZAOZGCZZOVPAGW-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|