C14H21BrN2O — CID 63609764
1-[3-bromo-4-(3,4-dimethylpiperazin-1-yl)phenyl]ethanol (PubChem CID 63609764) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 1-[3-bromo-4-(3,4-dimethylpiperazin-1-yl)phenyl]ethanol.
| Compound Name | 1-[3-bromo-4-(3,4-dimethylpiperazin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 63609764 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[3-bromo-4-(3,4-dimethylpiperazin-1-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCN(C)C(C)C2)c(Br)c1 |
| InChI | InChI=1S/C14H21BrN2O/c1-10-9-17(7-6-16(10)3)14-5-4-12(11(2)18)8-13(14)15/h4-5,8,10-11,18H,6-7,9H2,1-3H3 |
| InChIKey | XCOIWSIHFJDEBJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|