C14H20BrNO2 — CID 78941089
(1S)-1-[3-bromo-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]ethanol (PubChem CID 78941089) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[3-bromo-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78941089 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (1S)-1-[3-bromo-4-(2-methyl-1,4-oxazepan-4-yl)phenyl]ethanol |
| SMILES | CC1CN(c2ccc([C@H](C)O)cc2Br)CCCO1 |
| InChI | InChI=1S/C14H20BrNO2/c1-10-9-16(6-3-7-18-10)14-5-4-12(11(2)17)8-13(14)15/h4-5,8,10-11,17H,3,6-7,9H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | LTJXRUYVKSGTFD-DTIOYNMSSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|