C13H17ClN2O2 — CID 79005316
4-[2-chloro-4-[(1S)-1-hydroxyethyl]phenyl]-1,4-diazepan-2-one (PubChem CID 79005316) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 4-[2-chloro-4-[(1S)-1-hydroxyethyl]phenyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-chloro-4-[(1S)-1-hydroxyethyl]phenyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 79005316 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[2-chloro-4-[(1S)-1-hydroxyethyl]phenyl]-1,4-diazepan-2-one |
| SMILES | C[C@H](O)c1ccc(N2CCCNC(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-9(17)10-3-4-12(11(14)7-10)16-6-2-5-15-13(18)8-16/h3-4,7,9,17H,2,5-6,8H2,1H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | SCLUQTNEZXGSTN-VIFPVBQESA-N |
| XLogP | 1.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|