C12H16ClNO2S — CID 62908706
1-[3-chloro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol (PubChem CID 62908706) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-[3-chloro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol.
| Compound Name | 1-[3-chloro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 62908706 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[3-chloro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCS(=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-9(15)10-2-3-12(11(13)8-10)14-4-6-17(16)7-5-14/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | HTVBEVQCKFHZPK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|