C11H21N3 — CID 144770368
butane;7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 144770368) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is butane;7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
| Compound Name | butane;7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 144770368 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | butane;7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | CCCC.CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C7H11N3.C4H10/c1-9-4-5-10-3-2-8-7(10)6-9;1-3-4-2/h2-3H,4-6H2,1H3;3-4H2,1-2H3 |
| InChIKey | NXJYQVCNDXJGRJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |