C15H27N3 — CID 170207303
7-nonan-2-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 170207303) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 7-nonan-2-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
| Compound Name | 7-nonan-2-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 170207303 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 7-nonan-2-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | CCCCCCCC(C)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C15H27N3/c1-3-4-5-6-7-8-14(2)18-12-11-17-10-9-16-15(17)13-18/h9-10,14H,3-8,11-13H2,1-2H3 |
| InChIKey | IVFGBDOUCDFOPM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|