C12H22N4 — CID 63025679
4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-N-methylpentan-1-amine (PubChem CID 63025679) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-N-methylpentan-1-amine.
| Compound Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 63025679 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-N-methylpentan-1-amine |
| SMILES | CNCCCC(C)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H22N4/c1-11(4-3-5-13-2)16-9-8-15-7-6-14-12(15)10-16/h6-7,11,13H,3-5,8-10H2,1-2H3 |
| InChIKey | CEODXLQRDABBOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|