About 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 131232949) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| PubChem CID | 131232949 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | C/C=C/CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H15N3/c1-2-3-5-12-7-8-13-6-4-11-10(13)9-12/h2-4,6H,5,7-9H2,1H3/b3-2+ |
| InChIKey | NMPGMULMFSOIAR-NSCUHMNNSA-N |
| XLogP | 1.27 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 131232949) is 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is C/C=C/CN1CCn2ccnc2C1.
What is the InChIKey of 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is NMPGMULMFSOIAR-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H15N3/c1-2-3-5-12-7-8-13-6-4-11-10(13)9-12/h2-4,6H,5,7-9H2,1H3/b3-2+.
What are the key properties of 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 177.25 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 131232949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).