C10H15N3 — CID 131232949
7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 131232949) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
| Compound Name | 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 131232949 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 7-[(E)-but-2-enyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | C/C=C/CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H15N3/c1-2-3-5-12-7-8-13-6-4-11-10(13)9-12/h2-4,6H,5,7-9H2,1H3/b3-2+ |
| InChIKey | NMPGMULMFSOIAR-NSCUHMNNSA-N |
| XLogP | 1.27 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|