C9H14N4S — CID 116508456
N-ethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbothioamide (PubChem CID 116508456) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is N-ethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbothioamide.
| Compound Name | N-ethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbothioamide |
|---|---|
| PubChem CID | 116508456 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N-ethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbothioamide |
| SMILES | CCNC(=S)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C9H14N4S/c1-2-10-9(14)13-6-5-12-4-3-11-8(12)7-13/h3-4H,2,5-7H2,1H3,(H,10,14) |
| InChIKey | CMSBPDJEPCNAIQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|