C8H13N5S — CID 115620833
N-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioamide (PubChem CID 115620833) has the molecular formula C8H13N5S and a molecular weight of 211.29 g/mol. Its IUPAC name is N-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioamide.
| Compound Name | N-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioamide |
|---|---|
| PubChem CID | 115620833 |
| Molecular Formula | C8H13N5S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioamide |
| SMILES | CCNC(=S)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C8H13N5S/c1-2-9-8(14)12-3-4-13-6-10-11-7(13)5-12/h6H,2-5H2,1H3,(H,9,14) |
| InChIKey | RBHJBDWTBYGTBN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|