C8H14N6 — CID 64576019
N'-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide (PubChem CID 64576019) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is N'-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide.
| Compound Name | N'-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
|---|---|
| PubChem CID | 64576019 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | N'-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
| SMILES | CC/N=C(\N)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C8H14N6/c1-2-10-8(9)13-3-4-14-6-11-12-7(14)5-13/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | NEQJAORSQQTXMQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|