C11H17N5OS — CID 64577720
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)-3-methylbutanethioamide (PubChem CID 64577720) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)-3-methylbutanethioamide.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)-3-methylbutanethioamide |
|---|---|
| PubChem CID | 64577720 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)-3-methylbutanethioamide |
| SMILES | CC(C)C(C(=O)N1CCn2cnnc2C1)C(N)=S |
| InChI | InChI=1S/C11H17N5OS/c1-7(2)9(10(12)18)11(17)15-3-4-16-6-13-14-8(16)5-15/h6-7,9H,3-5H2,1-2H3,(H2,12,18) |
| InChIKey | DUKDFNYHPJDPEN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|