C9H17N7 — CID 104886758
N-amino-N'-propyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide (PubChem CID 104886758) has the molecular formula C9H17N7 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-amino-N'-propyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide.
| Compound Name | N-amino-N'-propyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
|---|---|
| PubChem CID | 104886758 |
| Molecular Formula | C9H17N7 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-amino-N'-propyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
| SMILES | CCC/N=C(\NN)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C9H17N7/c1-2-3-11-9(13-10)15-4-5-16-7-12-14-8(16)6-15/h7H,2-6,10H2,1H3,(H,11,13) |
| InChIKey | XGDCWWDLYFIDJZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|