C10H15N5O4 — CID 79463960
2-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonylamino)ethoxy]acetic acid (PubChem CID 79463960) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463960 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C10H15N5O4/c16-9(17)6-19-4-1-11-10(18)14-2-3-15-7-12-13-8(15)5-14/h7H,1-6H2,(H,11,18)(H,16,17) |
| InChIKey | JHPAPSGBCXYDCP-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|