C15H20N2O4 — CID 79463216
2-[2-(1,3,4,5-tetrahydro-2-benzazepine-2-carbonylamino)ethoxy]acetic acid (PubChem CID 79463216) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[2-(1,3,4,5-tetrahydro-2-benzazepine-2-carbonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(1,3,4,5-tetrahydro-2-benzazepine-2-carbonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463216 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[2-(1,3,4,5-tetrahydro-2-benzazepine-2-carbonylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H20N2O4/c18-14(19)11-21-9-7-16-15(20)17-8-3-6-12-4-1-2-5-13(12)10-17/h1-2,4-5H,3,6-11H2,(H,16,20)(H,18,19) |
| InChIKey | TUXRYBKJCKXGTP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|