C18H26N2O — CID 108888580
N-(2-cyclohexylethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 108888580) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-(2-cyclohexylethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 108888580 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(2-cyclohexylethyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(NCCC1CCCCC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H26N2O/c21-18(19-12-10-15-6-2-1-3-7-15)20-13-11-16-8-4-5-9-17(16)14-20/h4-5,8-9,15H,1-3,6-7,10-14H2,(H,19,21) |
| InChIKey | CRXIJNFYMKUQBJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |