C8H10BrN3O — CID 63680123
2-bromo-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanone (PubChem CID 63680123) has the molecular formula C8H10BrN3O and a molecular weight of 244.09 g/mol. Its IUPAC name is 2-bromo-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanone.
| Compound Name | 2-bromo-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanone |
|---|---|
| PubChem CID | 63680123 |
| Molecular Formula | C8H10BrN3O |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 2-bromo-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanone |
| SMILES | O=C(CBr)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C8H10BrN3O/c9-5-8(13)12-4-3-11-2-1-10-7(11)6-12/h1-2H,3-6H2 |
| InChIKey | DBALMIHQYBHRSJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|