C15H16N4OS — CID 63612528
4-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-oxoethyl]benzenecarbothioamide (PubChem CID 63612528) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-oxoethyl]benzenecarbothioamide.
| Compound Name | 4-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-oxoethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63612528 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-oxoethyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CC(=O)N2CCn3ccnc3C2)cc1 |
| InChI | InChI=1S/C15H16N4OS/c16-15(21)12-3-1-11(2-4-12)9-14(20)19-8-7-18-6-5-17-13(18)10-19/h1-6H,7-10H2,(H2,16,21) |
| InChIKey | HFTDJJVQADBAPW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|