C12H20N4O — CID 63027109
6-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)hexan-1-one (PubChem CID 63027109) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 6-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)hexan-1-one.
| Compound Name | 6-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)hexan-1-one |
|---|---|
| PubChem CID | 63027109 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 6-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)hexan-1-one |
| SMILES | NCCCCCC(=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H20N4O/c13-5-3-1-2-4-12(17)16-9-8-15-7-6-14-11(15)10-16/h6-7H,1-5,8-10,13H2 |
| InChIKey | RYUCLPPKKZDOAN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|