C10H18N4O2S — CID 55150709
4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)butan-1-amine (PubChem CID 55150709) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)butan-1-amine.
| Compound Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 55150709 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)butan-1-amine |
| SMILES | NCCCCS(=O)(=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H18N4O2S/c11-3-1-2-8-17(15,16)14-7-6-13-5-4-12-10(13)9-14/h4-5H,1-3,6-9,11H2 |
| InChIKey | WLLDZWYKKKWSPY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|