C13H19F2N5O2S — CID 71857301
4-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]sulfonylbutanenitrile (PubChem CID 71857301) has the molecular formula C13H19F2N5O2S and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]sulfonylbutanenitrile.
| Compound Name | 4-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 71857301 |
| Molecular Formula | C13H19F2N5O2S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]sulfonylbutanenitrile |
| SMILES | N#CCCCS(=O)(=O)N1CCN(Cc2nccn2C(F)F)CC1 |
| InChI | InChI=1S/C13H19F2N5O2S/c14-13(15)20-5-4-17-12(20)11-18-6-8-19(9-7-18)23(21,22)10-2-1-3-16/h4-5,13H,1-2,6-11H2 |
| InChIKey | YCKIXILQSNQHOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|