C13H25F3N4O3S — CID 89314347
2-[3-[2-(dimethylamino)ethyl]-2-methylimidazol-3-ium-1-yl]-N,N-dimethylethanamine;trifluoromethanesulfonate (PubChem CID 89314347) has the molecular formula C13H25F3N4O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethyl]-2-methylimidazol-3-ium-1-yl]-N,N-dimethylethanamine;trifluoromethanesulfonate.
| Compound Name | 2-[3-[2-(dimethylamino)ethyl]-2-methylimidazol-3-ium-1-yl]-N,N-dimethylethanamine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89314347 |
| Molecular Formula | C13H25F3N4O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[3-[2-(dimethylamino)ethyl]-2-methylimidazol-3-ium-1-yl]-N,N-dimethylethanamine;trifluoromethanesulfonate |
| SMILES | Cc1n(CCN(C)C)cc[n+]1CCN(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H25N4.CHF3O3S/c1-12-15(8-6-13(2)3)10-11-16(12)9-7-14(4)5;2-1(3,4)8(5,6)7/h10-11H,6-9H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GFWHNVRHDQXUPE-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 72.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|