C10H18F3N3O3S — CID 24787984
2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate (PubChem CID 24787984) has the molecular formula C10H18F3N3O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24787984 |
| Molecular Formula | C10H18F3N3O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate |
| SMILES | Cc1n(CCN(C)C)cc[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H18N3.CHF3O3S/c1-9-11(4)6-8-12(9)7-5-10(2)3;2-1(3,4)8(5,6)7/h6,8H,5,7H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KRCBUMCEHSRTRS-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 69.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|