C14H22F6N4O4S2 — CID 139246160
bis(trifluoromethylsulfonyl)azanide;1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl]piperidine (PubChem CID 139246160) has the molecular formula C14H22F6N4O4S2 and a molecular weight of 488.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl]piperidine.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 139246160 |
| Molecular Formula | C14H22F6N4O4S2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-[2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl]piperidine |
| SMILES | Cc1n(CCN2CCCCC2)cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H22N3.C2F6NO4S2/c1-12-13(2)8-10-15(12)11-9-14-6-4-3-5-7-14;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8,10H,3-7,9,11H2,1-2H3;/q+1;-1 |
| InChIKey | YMHQBFHYGADMLS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|