C11H21N3O2S — CID 164641693
N-[(2S)-1-imidazol-1-ylbutan-2-yl]butane-1-sulfonamide (PubChem CID 164641693) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[(2S)-1-imidazol-1-ylbutan-2-yl]butane-1-sulfonamide.
| Compound Name | N-[(2S)-1-imidazol-1-ylbutan-2-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 164641693 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-[(2S)-1-imidazol-1-ylbutan-2-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N[C@@H](CC)Cn1ccnc1 |
| InChI | InChI=1S/C11H21N3O2S/c1-3-5-8-17(15,16)13-11(4-2)9-14-7-6-12-10-14/h6-7,10-11,13H,3-5,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | RSWDJGUQWAOBCT-NSHDSACASA-N |
| XLogP | 1.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |