C12H21F3N2O6S2 — CID 11475374
4-(3-butylimidazol-1-ium-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonate (PubChem CID 11475374) has the molecular formula C12H21F3N2O6S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 4-(3-butylimidazol-1-ium-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonate.
| Compound Name | 4-(3-butylimidazol-1-ium-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11475374 |
| Molecular Formula | C12H21F3N2O6S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-(3-butylimidazol-1-ium-1-yl)butane-1-sulfonic acid;trifluoromethanesulfonate |
| SMILES | CCCCn1cc[n+](CCCCS(=O)(=O)O)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H20N2O3S.CHF3O3S/c1-2-3-6-12-8-9-13(11-12)7-4-5-10-17(14,15)16;2-1(3,4)8(5,6)7/h8-9,11H,2-7,10H2,1H3;(H,5,6,7) |
| InChIKey | JJUNHKAVFOFCHX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|