C9H19N4O2S+ — CID 71619312
4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide (PubChem CID 71619312) has the molecular formula C9H19N4O2S+ and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide.
| Compound Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide |
|---|---|
| PubChem CID | 71619312 |
| Molecular Formula | C9H19N4O2S+ |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide |
| SMILES | Cc1n(CCCCS(=O)(=O)NN)cc[n+]1C |
| InChI | InChI=1S/C9H19N4O2S/c1-9-12(2)6-7-13(9)5-3-4-8-16(14,15)11-10/h6-7,11H,3-5,8,10H2,1-2H3/q+1 |
| InChIKey | YFGZGAAVBDOCMI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|