C13H24N4O2S — CID 118743097
N,N-dimethyl-1-(8-propylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methanamine (PubChem CID 118743097) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N,N-dimethyl-1-(8-propylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(8-propylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methanamine |
|---|---|
| PubChem CID | 118743097 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N,N-dimethyl-1-(8-propylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methanamine |
| SMILES | CCCS(=O)(=O)N1Cc2nccn2CC(CN(C)C)C1 |
| InChI | InChI=1S/C13H24N4O2S/c1-4-7-20(18,19)17-10-12(8-15(2)3)9-16-6-5-14-13(16)11-17/h5-6,12H,4,7-11H2,1-3H3 |
| InChIKey | GKRDWRGBQZZIGY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |