C13H20N6O2S — CID 118739258
6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-methylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118739258) has the molecular formula C13H20N6O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-methylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-methylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118739258 |
| Molecular Formula | C13H20N6O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-methylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | Cc1nc(C)n(CC2CN(S(C)(=O)=O)Cc3nccn3C2)n1 |
| InChI | InChI=1S/C13H20N6O2S/c1-10-15-11(2)19(16-10)8-12-6-17-5-4-14-13(17)9-18(7-12)22(3,20)21/h4-5,12H,6-9H2,1-3H3 |
| InChIKey | UEVMZXXMSDRCAC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |