C12H18N6O2S — CID 118740749
8-ethylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118740749) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 8-ethylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 8-ethylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118740749 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 8-ethylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | CCS(=O)(=O)N1Cc2nccn2CC(Cn2cncn2)C1 |
| InChI | InChI=1S/C12H18N6O2S/c1-2-21(19,20)18-7-11(6-17-10-13-9-15-17)5-16-4-3-14-12(16)8-18/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | ITAXJINSXBTJMH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |